C9H9BrClFO2 — CID 171859545
3-bromo-1-(2-chloro-5-fluorophenyl)propane-1,2-diol (PubChem CID 171859545) has the molecular formula C9H9BrClFO2 and a molecular weight of 283.52 g/mol. Its IUPAC name is 3-bromo-1-(2-chloro-5-fluorophenyl)propane-1,2-diol.
| Compound Name | 3-bromo-1-(2-chloro-5-fluorophenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171859545 |
| Molecular Formula | C9H9BrClFO2 |
| Molecular Weight | 283.52 g/mol |
| Exact Mass | 281.95 |
| IUPAC Name | 3-bromo-1-(2-chloro-5-fluorophenyl)propane-1,2-diol |
| SMILES | OC(CBr)C(O)c1cc(F)ccc1Cl |
| InChI | InChI=1S/C9H9BrClFO2/c10-4-8(13)9(14)6-3-5(12)1-2-7(6)11/h1-3,8-9,13-14H,4H2 |
| InChIKey | RVJRBWOTDVBIMI-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.52 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|