C18H10Cl5P — CID 17186031
(2,3,4,5,6-pentachlorophenyl)-diphenylphosphane (PubChem CID 17186031) has the molecular formula C18H10Cl5P and a molecular weight of 434.52 g/mol. Its IUPAC name is (2,3,4,5,6-pentachlorophenyl)-diphenylphosphane.
| Compound Name | (2,3,4,5,6-pentachlorophenyl)-diphenylphosphane |
|---|---|
| PubChem CID | 17186031 |
| Molecular Formula | C18H10Cl5P |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 431.90 |
| IUPAC Name | (2,3,4,5,6-pentachlorophenyl)-diphenylphosphane |
| SMILES | Clc1c(Cl)c(Cl)c(P(c2ccccc2)c2ccccc2)c(Cl)c1Cl |
| InChI | InChI=1S/C18H10Cl5P/c19-13-14(20)16(22)18(17(23)15(13)21)24(11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | KKBCSXSHMJPZHP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|