About 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid
2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid (PubChem CID 17186043) has the molecular formula C11H10O5
and a molecular weight of 222.20 g/mol. Its IUPAC name is 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid |
| PubChem CID | 17186043 |
| Molecular Formula | C11H10O5 |
| Molecular Weight | 222.20 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid |
| SMILES | O=C(O)CC12C(=O)OC(=O)C1C1C=CC2C1 |
| InChI | InChI=1S/C11H10O5/c12-7(13)4-11-6-2-1-5(3-6)8(11)9(14)16-10(11)15/h1-2,5-6,8H,3-4H2,(H,12,13) |
| InChIKey | AYQUZZFBHRSOKG-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.20 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid?
The IUPAC name of 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid (CID 17186043) is 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid.
What is the SMILES notation for 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid?
The canonical SMILES for 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid is O=C(O)CC12C(=O)OC(=O)C1C1C=CC2C1.
What is the InChIKey of 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid?
The InChIKey is AYQUZZFBHRSOKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O5/c12-7(13)4-11-6-2-1-5(3-6)8(11)9(14)16-10(11)15/h1-2,5-6,8H,3-4H2,(H,12,13).
What are the key properties of 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid?
2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid has a molecular weight of 222.20 g/mol, XLogP of 0.35, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dioxo-4-oxatricyclo[5.2.1.02,6]dec-8-en-2-yl)acetic acid is sourced from PubChem (CID 17186043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).