C13H18BrNO3 — CID 171861252
3-bromo-1-(2-morpholin-4-ylphenyl)propane-1,2-diol (PubChem CID 171861252) has the molecular formula C13H18BrNO3 and a molecular weight of 316.19 g/mol. Its IUPAC name is 3-bromo-1-(2-morpholin-4-ylphenyl)propane-1,2-diol.
| Compound Name | 3-bromo-1-(2-morpholin-4-ylphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171861252 |
| Molecular Formula | C13H18BrNO3 |
| Molecular Weight | 316.19 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 3-bromo-1-(2-morpholin-4-ylphenyl)propane-1,2-diol |
| SMILES | OC(CBr)C(O)c1ccccc1N1CCOCC1 |
| InChI | InChI=1S/C13H18BrNO3/c14-9-12(16)13(17)10-3-1-2-4-11(10)15-5-7-18-8-6-15/h1-4,12-13,16-17H,5-9H2 |
| InChIKey | HPCWJDNXGKTTSG-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.19 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|