C9H10Cl2O3 — CID 171863335
3-chloro-1-(3-chloro-2-hydroxyphenyl)propane-1,2-diol (PubChem CID 171863335) has the molecular formula C9H10Cl2O3 and a molecular weight of 237.08 g/mol. Its IUPAC name is 3-chloro-1-(3-chloro-2-hydroxyphenyl)propane-1,2-diol.
| Compound Name | 3-chloro-1-(3-chloro-2-hydroxyphenyl)propane-1,2-diol |
|---|---|
| PubChem CID | 171863335 |
| Molecular Formula | C9H10Cl2O3 |
| Molecular Weight | 237.08 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | 3-chloro-1-(3-chloro-2-hydroxyphenyl)propane-1,2-diol |
| SMILES | Oc1c(Cl)cccc1C(O)C(O)CCl |
| InChI | InChI=1S/C9H10Cl2O3/c10-4-7(12)9(14)5-2-1-3-6(11)8(5)13/h1-3,7,9,12-14H,4H2 |
| InChIKey | JERVSPMFJAOHMP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.08 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|