About 6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione
6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (PubChem CID 17186583) has the molecular formula C16H14N4O4
and a molecular weight of 326.31 g/mol. Its IUPAC name is 6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
Molecular Properties
| Compound Name | 6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| PubChem CID | 17186583 |
| Molecular Formula | C16H14N4O4 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione |
| SMILES | Cc1c(/C=C/c2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])c2ccccc2n1C |
| InChI | InChI=1S/C16H14N4O4/c1-9-10(11-5-3-4-6-13(11)19(9)2)7-8-12-14(20(23)24)15(21)18-16(22)17-12/h3-8H,1-2H3,(H2,17,18,21,22)/b8-7+ |
| InChIKey | LAXSLZNMQLWJPM-BQYQJAHWSA-N |
| XLogP | 1.94 |
| TPSA | 113.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione?
The IUPAC name of 6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione (CID 17186583) is 6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione.
What is the SMILES notation for 6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione?
The canonical SMILES for 6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione is Cc1c(/C=C/c2[nH]c(=O)[nH]c(=O)c2[N+](=O)[O-])c2ccccc2n1C.
What is the InChIKey of 6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione?
The InChIKey is LAXSLZNMQLWJPM-BQYQJAHWSA-N. The full InChI is InChI=1S/C16H14N4O4/c1-9-10(11-5-3-4-6-13(11)19(9)2)7-8-12-14(20(23)24)15(21)18-16(22)17-12/h3-8H,1-2H3,(H2,17,18,21,22)/b8-7+.
What are the key properties of 6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione?
6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione has a molecular weight of 326.31 g/mol, XLogP of 1.94, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(E)-2-(1,2-dimethylindol-3-yl)ethenyl]-5-nitro-1H-pyrimidine-2,4-dione is sourced from PubChem (CID 17186583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).