C8H10N2O5 — CID 171867927
2,3-dihydroxy-3-(5-hydroxy-6-oxo-1H-pyridin-3-yl)propanamide (PubChem CID 171867927) has the molecular formula C8H10N2O5 and a molecular weight of 214.18 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(5-hydroxy-6-oxo-1H-pyridin-3-yl)propanamide.
| Compound Name | 2,3-dihydroxy-3-(5-hydroxy-6-oxo-1H-pyridin-3-yl)propanamide |
|---|---|
| PubChem CID | 171867927 |
| Molecular Formula | C8H10N2O5 |
| Molecular Weight | 214.18 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 2,3-dihydroxy-3-(5-hydroxy-6-oxo-1H-pyridin-3-yl)propanamide |
| SMILES | NC(=O)C(O)C(O)c1c[nH]c(=O)c(O)c1 |
| InChI | InChI=1S/C8H10N2O5/c9-7(14)6(13)5(12)3-1-4(11)8(15)10-2-3/h1-2,5-6,11-13H,(H2,9,14)(H,10,15) |
| InChIKey | KXUZCQQMARGETM-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 136.64 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.18 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |