C10H11NO5S — CID 171868424
(E)-3-[4-(3-amino-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]prop-2-enoic acid (PubChem CID 171868424) has the molecular formula C10H11NO5S and a molecular weight of 257.27 g/mol. Its IUPAC name is (E)-3-[4-(3-amino-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(3-amino-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 171868424 |
| Molecular Formula | C10H11NO5S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | (E)-3-[4-(3-amino-1,2-dihydroxy-3-oxopropyl)thiophen-2-yl]prop-2-enoic acid |
| SMILES | NC(=O)C(O)C(O)c1csc(/C=C/C(=O)O)c1 |
| InChI | InChI=1S/C10H11NO5S/c11-10(16)9(15)8(14)5-3-6(17-4-5)1-2-7(12)13/h1-4,8-9,14-15H,(H2,11,16)(H,12,13)/b2-1+ |
| InChIKey | KSGIEBYVKWFLSN-OWOJBTEDSA-N |
| XLogP | -0.27 |
| TPSA | 120.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|