C15H11NO6 — CID 171869198
3-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)-2,3-dihydroxypropanamide (PubChem CID 171869198) has the molecular formula C15H11NO6 and a molecular weight of 301.25 g/mol. Its IUPAC name is 3-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)-2,3-dihydroxypropanamide.
| Compound Name | 3-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)-2,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 171869198 |
| Molecular Formula | C15H11NO6 |
| Molecular Weight | 301.25 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 3-(2,4-dioxo-3-oxatricyclo[7.3.1.05,13]trideca-1(12),5(13),6,8,10-pentaen-8-yl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1ccc2c3c(cccc13)C(=O)OC2=O |
| InChI | InChI=1S/C15H11NO6/c16-13(19)12(18)11(17)7-4-5-9-10-6(7)2-1-3-8(10)14(20)22-15(9)21/h1-5,11-12,17-18H,(H2,16,19) |
| InChIKey | FGXRFVWGQPMPNI-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 126.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.25 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|