About 3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide
3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide (PubChem CID 171869536) has the molecular formula C7H8ClNO3S
and a molecular weight of 221.66 g/mol. Its IUPAC name is 3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide.
Molecular Properties
| Compound Name | 3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide |
| PubChem CID | 171869536 |
| Molecular Formula | C7H8ClNO3S |
| Molecular Weight | 221.66 g/mol |
| Exact Mass | 220.99 |
| IUPAC Name | 3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1sccc1Cl |
| InChI | InChI=1S/C7H8ClNO3S/c8-3-1-2-13-6(3)4(10)5(11)7(9)12/h1-2,4-5,10-11H,(H2,9,12) |
| InChIKey | UFNLZRXNZWIYGR-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.66 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide?
The IUPAC name of 3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide (CID 171869536) is 3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide.
What is the SMILES notation for 3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide?
The canonical SMILES for 3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide is NC(=O)C(O)C(O)c1sccc1Cl.
What is the InChIKey of 3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide?
The InChIKey is UFNLZRXNZWIYGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8ClNO3S/c8-3-1-2-13-6(3)4(10)5(11)7(9)12/h1-2,4-5,10-11H,(H2,9,12).
What are the key properties of 3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide?
3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide has a molecular weight of 221.66 g/mol, XLogP of 0.28, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chlorothiophen-2-yl)-2,3-dihydroxypropanamide is sourced from PubChem (CID 171869536), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).