About 3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide
3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide (PubChem CID 171869611) has the molecular formula C7H7Cl2N3O3
and a molecular weight of 252.06 g/mol. Its IUPAC name is 3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide.
Molecular Properties
| Compound Name | 3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide |
| PubChem CID | 171869611 |
| Molecular Formula | C7H7Cl2N3O3 |
| Molecular Weight | 252.06 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide |
| SMILES | NC(=O)C(O)C(O)c1c(Cl)ncnc1Cl |
| InChI | InChI=1S/C7H7Cl2N3O3/c8-5-2(6(9)12-1-11-5)3(13)4(14)7(10)15/h1,3-4,13-14H,(H2,10,15) |
| InChIKey | FUBCTOBNOMNQNQ-UHFFFAOYSA-N |
| XLogP | -0.34 |
| TPSA | 109.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.06 |
| LogP ≤ 5 | -0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide?
The IUPAC name of 3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide (CID 171869611) is 3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide.
What is the SMILES notation for 3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide?
The canonical SMILES for 3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide is NC(=O)C(O)C(O)c1c(Cl)ncnc1Cl.
What is the InChIKey of 3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide?
The InChIKey is FUBCTOBNOMNQNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7Cl2N3O3/c8-5-2(6(9)12-1-11-5)3(13)4(14)7(10)15/h1,3-4,13-14H,(H2,10,15).
What are the key properties of 3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide?
3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide has a molecular weight of 252.06 g/mol, XLogP of -0.34, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,6-dichloropyrimidin-5-yl)-2,3-dihydroxypropanamide is sourced from PubChem (CID 171869611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).