About 5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one
5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one (PubChem CID 171873778) has the molecular formula C8H12N2O4S
and a molecular weight of 232.26 g/mol. Its IUPAC name is 5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one |
| PubChem CID | 171873778 |
| Molecular Formula | C8H12N2O4S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | 5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(O)c1C(O)C(O)CCS |
| InChI | InChI=1S/C8H12N2O4S/c11-4(1-2-15)6(12)5-7(13)9-3-10-8(5)14/h3-4,6,11-12,15H,1-2H2,(H2,9,10,13,14) |
| InChIKey | FUFPIDKFHYEEJI-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one?
The IUPAC name of 5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one (CID 171873778) is 5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one.
What is the SMILES notation for 5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one?
The canonical SMILES for 5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one is O=c1[nH]cnc(O)c1C(O)C(O)CCS.
What is the InChIKey of 5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one?
The InChIKey is FUFPIDKFHYEEJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O4S/c11-4(1-2-15)6(12)5-7(13)9-3-10-8(5)14/h3-4,6,11-12,15H,1-2H2,(H2,9,10,13,14).
What are the key properties of 5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one?
5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one has a molecular weight of 232.26 g/mol, XLogP of -0.81, 4 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,2-dihydroxy-4-sulfanylbutyl)-4-hydroxy-1H-pyrimidin-6-one is sourced from PubChem (CID 171873778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).