C15H16O3S — CID 171874903
1-(1,2-dihydroxy-4-sulfanylbutyl)naphthalene-2-carbaldehyde (PubChem CID 171874903) has the molecular formula C15H16O3S and a molecular weight of 276.36 g/mol. Its IUPAC name is 1-(1,2-dihydroxy-4-sulfanylbutyl)naphthalene-2-carbaldehyde.
| Compound Name | 1-(1,2-dihydroxy-4-sulfanylbutyl)naphthalene-2-carbaldehyde |
|---|---|
| PubChem CID | 171874903 |
| Molecular Formula | C15H16O3S |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-(1,2-dihydroxy-4-sulfanylbutyl)naphthalene-2-carbaldehyde |
| SMILES | O=Cc1ccc2ccccc2c1C(O)C(O)CCS |
| InChI | InChI=1S/C15H16O3S/c16-9-11-6-5-10-3-1-2-4-12(10)14(11)15(18)13(17)7-8-19/h1-6,9,13,15,17-19H,7-8H2 |
| InChIKey | GZVXSGFEEZZIGT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|