C12H20N2O3S — CID 171875541
S-[3,4-dihydroxy-4-(1,3,5-trimethylpyrazol-4-yl)butyl] ethanethioate (PubChem CID 171875541) has the molecular formula C12H20N2O3S and a molecular weight of 272.37 g/mol. Its IUPAC name is S-[3,4-dihydroxy-4-(1,3,5-trimethylpyrazol-4-yl)butyl] ethanethioate.
| Compound Name | S-[3,4-dihydroxy-4-(1,3,5-trimethylpyrazol-4-yl)butyl] ethanethioate |
|---|---|
| PubChem CID | 171875541 |
| Molecular Formula | C12H20N2O3S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | S-[3,4-dihydroxy-4-(1,3,5-trimethylpyrazol-4-yl)butyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C12H20N2O3S/c1-7-11(8(2)14(4)13-7)12(17)10(16)5-6-18-9(3)15/h10,12,16-17H,5-6H2,1-4H3 |
| InChIKey | MFWDWJNIQNCLJW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|