C12H13Cl2N3O3S — CID 171877042
S-[4-(2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-3,4-dihydroxybutyl] ethanethioate (PubChem CID 171877042) has the molecular formula C12H13Cl2N3O3S and a molecular weight of 350.23 g/mol. Its IUPAC name is S-[4-(2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-3,4-dihydroxybutyl] ethanethioate.
| Compound Name | S-[4-(2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-3,4-dihydroxybutyl] ethanethioate |
|---|---|
| PubChem CID | 171877042 |
| Molecular Formula | C12H13Cl2N3O3S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | S-[4-(2,4-dichloro-7H-pyrrolo[2,3-d]pyrimidin-5-yl)-3,4-dihydroxybutyl] ethanethioate |
| SMILES | CC(=O)SCCC(O)C(O)c1c[nH]c2nc(Cl)nc(Cl)c12 |
| InChI | InChI=1S/C12H13Cl2N3O3S/c1-5(18)21-3-2-7(19)9(20)6-4-15-11-8(6)10(13)16-12(14)17-11/h4,7,9,19-20H,2-3H2,1H3,(H,15,16,17) |
| InChIKey | YYBLBCAKOJGORF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|