C17H15BrCl2O2 — CID 17187782
(2-bromo-4-butan-2-ylphenyl) 2,4-dichlorobenzoate (PubChem CID 17187782) has the molecular formula C17H15BrCl2O2 and a molecular weight of 402.12 g/mol. Its IUPAC name is (2-bromo-4-butan-2-ylphenyl) 2,4-dichlorobenzoate.
| Compound Name | (2-bromo-4-butan-2-ylphenyl) 2,4-dichlorobenzoate |
|---|---|
| PubChem CID | 17187782 |
| Molecular Formula | C17H15BrCl2O2 |
| Molecular Weight | 402.12 g/mol |
| Exact Mass | 399.96 |
| IUPAC Name | (2-bromo-4-butan-2-ylphenyl) 2,4-dichlorobenzoate |
| SMILES | CCC(C)c1ccc(OC(=O)c2ccc(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C17H15BrCl2O2/c1-3-10(2)11-4-7-16(14(18)8-11)22-17(21)13-6-5-12(19)9-15(13)20/h4-10H,3H2,1-2H3 |
| InChIKey | NLLDSHSQRMBCGG-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.12 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|