3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid

C11H13NO6 — CID 171878151

IUPAC3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid
SMILESCc1cccc([N+](=O)[O-])c1C(O)C(O)CC(=O)O
InChIInChI=1S/C11H13NO6/c1-6-3-2-4-7(12(17)18)10(6)11(16)8(13)5-9(14)15/h2-4,8,11,13,16H,5H2,1H3,(H,14,15)
InChIKeyFFLDRVDVOXDXSK-UHFFFAOYSA-N
MW255.23 g/mol
LogP0.77
Rot. Bonds5

About 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid

3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid (PubChem CID 171878151) has the molecular formula C11H13NO6 and a molecular weight of 255.23 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid.

Molecular Properties

Compound Name3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid
PubChem CID171878151
Molecular FormulaC11H13NO6
Molecular Weight255.23 g/mol
Exact Mass255.07
IUPAC Name3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid
SMILESCc1cccc([N+](=O)[O-])c1C(O)C(O)CC(=O)O
InChIInChI=1S/C11H13NO6/c1-6-3-2-4-7(12(17)18)10(6)11(16)8(13)5-9(14)15/h2-4,8,11,13,16H,5H2,1H3,(H,14,15)
InChIKeyFFLDRVDVOXDXSK-UHFFFAOYSA-N
XLogP0.77
TPSA120.90 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.23
LogP ≤ 50.77
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid?
The IUPAC name of 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid (CID 171878151) is 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid.
What is the SMILES notation for 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid?
The canonical SMILES for 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid is Cc1cccc([N+](=O)[O-])c1C(O)C(O)CC(=O)O.
What is the InChIKey of 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid?
The InChIKey is FFLDRVDVOXDXSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO6/c1-6-3-2-4-7(12(17)18)10(6)11(16)8(13)5-9(14)15/h2-4,8,11,13,16H,5H2,1H3,(H,14,15).
What are the key properties of 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid?
3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid has a molecular weight of 255.23 g/mol, XLogP of 0.77, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid is sourced from PubChem (CID 171878151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).