C11H13NO6 — CID 171878151
3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid (PubChem CID 171878151) has the molecular formula C11H13NO6 and a molecular weight of 255.23 g/mol. Its IUPAC name is 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid.
| Compound Name | 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid |
|---|---|
| PubChem CID | 171878151 |
| Molecular Formula | C11H13NO6 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 3,4-dihydroxy-4-(2-methyl-6-nitrophenyl)butanoic acid |
| SMILES | Cc1cccc([N+](=O)[O-])c1C(O)C(O)CC(=O)O |
| InChI | InChI=1S/C11H13NO6/c1-6-3-2-4-7(12(17)18)10(6)11(16)8(13)5-9(14)15/h2-4,8,11,13,16H,5H2,1H3,(H,14,15) |
| InChIKey | FFLDRVDVOXDXSK-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|