C10H17N5O2 — CID 171879122
4-azido-1-(1,3,5-trimethylpyrazol-4-yl)butane-1,2-diol (PubChem CID 171879122) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is 4-azido-1-(1,3,5-trimethylpyrazol-4-yl)butane-1,2-diol.
| Compound Name | 4-azido-1-(1,3,5-trimethylpyrazol-4-yl)butane-1,2-diol |
|---|---|
| PubChem CID | 171879122 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 4-azido-1-(1,3,5-trimethylpyrazol-4-yl)butane-1,2-diol |
| SMILES | Cc1nn(C)c(C)c1C(O)C(O)CCN=[N+]=[N-] |
| InChI | InChI=1S/C10H17N5O2/c1-6-9(7(2)15(3)13-6)10(17)8(16)4-5-12-14-11/h8,10,16-17H,4-5H2,1-3H3 |
| InChIKey | DFYUCEJJGWOAFC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 107.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|