C28H30N4O4 — CID 17188207
1-N,4-N-bis[4-(2-methylpropanoylamino)phenyl]benzene-1,4-dicarboxamide (PubChem CID 17188207) has the molecular formula C28H30N4O4 and a molecular weight of 486.57 g/mol. Its IUPAC name is 1-N,4-N-bis[4-(2-methylpropanoylamino)phenyl]benzene-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[4-(2-methylpropanoylamino)phenyl]benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 17188207 |
| Molecular Formula | C28H30N4O4 |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.23 |
| IUPAC Name | 1-N,4-N-bis[4-(2-methylpropanoylamino)phenyl]benzene-1,4-dicarboxamide |
| SMILES | CC(C)C(=O)Nc1ccc(NC(=O)c2ccc(C(=O)Nc3ccc(NC(=O)C(C)C)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H30N4O4/c1-17(2)25(33)29-21-9-13-23(14-10-21)31-27(35)19-5-7-20(8-6-19)28(36)32-24-15-11-22(12-16-24)30-26(34)18(3)4/h5-18H,1-4H3,(H,29,33)(H,30,34)(H,31,35)(H,32,36) |
| InChIKey | JGEUHZWTOASQIK-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |