About 3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate
3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate (PubChem CID 17188622) has the molecular formula C24H29N3O4S
and a molecular weight of 455.58 g/mol. Its IUPAC name is 3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate.
Molecular Properties
| Compound Name | 3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate |
| PubChem CID | 17188622 |
| Molecular Formula | C24H29N3O4S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.19 |
| IUPAC Name | 3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate |
| SMILES | CCC(=O)Nc1cccc(NC(=S)NC(=O)CCCC(=O)OCCCc2ccccc2)c1 |
| InChI | InChI=1S/C24H29N3O4S/c1-2-21(28)25-19-12-6-13-20(17-19)26-24(32)27-22(29)14-7-15-23(30)31-16-8-11-18-9-4-3-5-10-18/h3-6,9-10,12-13,17H,2,7-8,11,14-16H2,1H3,(H,25,28)(H2,26,27,29,32) |
| InChIKey | TZWSTCYVGKBYSA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate?
The IUPAC name of 3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate (CID 17188622) is 3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate.
What is the SMILES notation for 3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate?
The canonical SMILES for 3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate is CCC(=O)Nc1cccc(NC(=S)NC(=O)CCCC(=O)OCCCc2ccccc2)c1.
What is the InChIKey of 3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate?
The InChIKey is TZWSTCYVGKBYSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H29N3O4S/c1-2-21(28)25-19-12-6-13-20(17-19)26-24(32)27-22(29)14-7-15-23(30)31-16-8-11-18-9-4-3-5-10-18/h3-6,9-10,12-13,17H,2,7-8,11,14-16H2,1H3,(H,25,28)(H2,26,27,29,32).
What are the key properties of 3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate?
3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate has a molecular weight of 455.58 g/mol, XLogP of 4.19, 11 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpropyl 5-oxo-5-[[3-(propanoylamino)phenyl]carbamothioylamino]pentanoate is sourced from PubChem (CID 17188622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).