About 5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one
5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one (PubChem CID 171890210) has the molecular formula C10H17N3O3S
and a molecular weight of 259.33 g/mol. Its IUPAC name is 5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one |
| PubChem CID | 171890210 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one |
| SMILES | CNCCC(O)C(O)c1cnc(SC)[nH]c1=O |
| InChI | InChI=1S/C10H17N3O3S/c1-11-4-3-7(14)8(15)6-5-12-10(17-2)13-9(6)16/h5,7-8,11,14-15H,3-4H2,1-2H3,(H,12,13,16) |
| InChIKey | LOZFHGZHUPUDJZ-UHFFFAOYSA-N |
| XLogP | -0.50 |
| TPSA | 98.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one?
The IUPAC name of 5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one (CID 171890210) is 5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one.
What is the SMILES notation for 5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one?
The canonical SMILES for 5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one is CNCCC(O)C(O)c1cnc(SC)[nH]c1=O.
What is the InChIKey of 5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one?
The InChIKey is LOZFHGZHUPUDJZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O3S/c1-11-4-3-7(14)8(15)6-5-12-10(17-2)13-9(6)16/h5,7-8,11,14-15H,3-4H2,1-2H3,(H,12,13,16).
What are the key properties of 5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one?
5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one has a molecular weight of 259.33 g/mol, XLogP of -0.50, 6 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1,2-dihydroxy-4-(methylamino)butyl]-2-methylsulfanyl-1H-pyrimidin-6-one is sourced from PubChem (CID 171890210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).