C29H33BrN2O2 — CID 17189574
1-(4-benzhydrylpiperazin-1-yl)-2-(2-bromo-4-butan-2-ylphenoxy)ethanone (PubChem CID 17189574) has the molecular formula C29H33BrN2O2 and a molecular weight of 521.50 g/mol. Its IUPAC name is 1-(4-benzhydrylpiperazin-1-yl)-2-(2-bromo-4-butan-2-ylphenoxy)ethanone.
| Compound Name | 1-(4-benzhydrylpiperazin-1-yl)-2-(2-bromo-4-butan-2-ylphenoxy)ethanone |
|---|---|
| PubChem CID | 17189574 |
| Molecular Formula | C29H33BrN2O2 |
| Molecular Weight | 521.50 g/mol |
| Exact Mass | 520.17 |
| IUPAC Name | 1-(4-benzhydrylpiperazin-1-yl)-2-(2-bromo-4-butan-2-ylphenoxy)ethanone |
| SMILES | CCC(C)c1ccc(OCC(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)c(Br)c1 |
| InChI | InChI=1S/C29H33BrN2O2/c1-3-22(2)25-14-15-27(26(30)20-25)34-21-28(33)31-16-18-32(19-17-31)29(23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-15,20,22,29H,3,16-19,21H2,1-2H3 |
| InChIKey | PHAAPYAUOWVYDX-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.50 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |