C22H28BrNO4 — CID 17189618
2-(2-bromo-4-butan-2-ylphenoxy)-N-[4-(2-ethoxyethoxy)phenyl]acetamide (PubChem CID 17189618) has the molecular formula C22H28BrNO4 and a molecular weight of 450.37 g/mol. Its IUPAC name is 2-(2-bromo-4-butan-2-ylphenoxy)-N-[4-(2-ethoxyethoxy)phenyl]acetamide.
| Compound Name | 2-(2-bromo-4-butan-2-ylphenoxy)-N-[4-(2-ethoxyethoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 17189618 |
| Molecular Formula | C22H28BrNO4 |
| Molecular Weight | 450.37 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 2-(2-bromo-4-butan-2-ylphenoxy)-N-[4-(2-ethoxyethoxy)phenyl]acetamide |
| SMILES | CCOCCOc1ccc(NC(=O)COc2ccc(C(C)CC)cc2Br)cc1 |
| InChI | InChI=1S/C22H28BrNO4/c1-4-16(3)17-6-11-21(20(23)14-17)28-15-22(25)24-18-7-9-19(10-8-18)27-13-12-26-5-2/h6-11,14,16H,4-5,12-13,15H2,1-3H3,(H,24,25) |
| InChIKey | DNZWRHYMLJTBNM-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.37 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|