About 4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide
4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide (PubChem CID 171898570) has the molecular formula C8H10ClNO3S
and a molecular weight of 235.69 g/mol. Its IUPAC name is 4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide.
Molecular Properties
| Compound Name | 4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide |
| PubChem CID | 171898570 |
| Molecular Formula | C8H10ClNO3S |
| Molecular Weight | 235.69 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccsc1Cl |
| InChI | InChI=1S/C8H10ClNO3S/c9-8-4(1-2-14-8)7(13)5(11)3-6(10)12/h1-2,5,7,11,13H,3H2,(H2,10,12) |
| InChIKey | HNLKCBCIHKKYSO-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.69 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide?
The IUPAC name of 4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide (CID 171898570) is 4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide.
What is the SMILES notation for 4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide?
The canonical SMILES for 4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide is NC(=O)CC(O)C(O)c1ccsc1Cl.
What is the InChIKey of 4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide?
The InChIKey is HNLKCBCIHKKYSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO3S/c9-8-4(1-2-14-8)7(13)5(11)3-6(10)12/h1-2,5,7,11,13H,3H2,(H2,10,12).
What are the key properties of 4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide?
4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide has a molecular weight of 235.69 g/mol, XLogP of 0.67, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2-chlorothiophen-3-yl)-3,4-dihydroxybutanamide is sourced from PubChem (CID 171898570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).