About 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide
4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide (PubChem CID 171898602) has the molecular formula C9H11NO5
and a molecular weight of 213.19 g/mol. Its IUPAC name is 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide.
Molecular Properties
| Compound Name | 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide |
| PubChem CID | 171898602 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc(C=O)o1 |
| InChI | InChI=1S/C9H11NO5/c10-8(13)3-6(12)9(14)7-2-1-5(4-11)15-7/h1-2,4,6,9,12,14H,3H2,(H2,10,13) |
| InChIKey | QAVKTTKCRYVJPJ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide?
The IUPAC name of 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide (CID 171898602) is 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide.
What is the SMILES notation for 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide?
The canonical SMILES for 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide is NC(=O)CC(O)C(O)c1ccc(C=O)o1.
What is the InChIKey of 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide?
The InChIKey is QAVKTTKCRYVJPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO5/c10-8(13)3-6(12)9(14)7-2-1-5(4-11)15-7/h1-2,4,6,9,12,14H,3H2,(H2,10,13).
What are the key properties of 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide?
4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide has a molecular weight of 213.19 g/mol, XLogP of -0.64, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide is sourced from PubChem (CID 171898602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).