C9H11NO5 — CID 171898602
4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide (PubChem CID 171898602) has the molecular formula C9H11NO5 and a molecular weight of 213.19 g/mol. Its IUPAC name is 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide.
| Compound Name | 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide |
|---|---|
| PubChem CID | 171898602 |
| Molecular Formula | C9H11NO5 |
| Molecular Weight | 213.19 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 4-(5-formylfuran-2-yl)-3,4-dihydroxybutanamide |
| SMILES | NC(=O)CC(O)C(O)c1ccc(C=O)o1 |
| InChI | InChI=1S/C9H11NO5/c10-8(13)3-6(12)9(14)7-2-1-5(4-11)15-7/h1-2,4,6,9,12,14H,3H2,(H2,10,13) |
| InChIKey | QAVKTTKCRYVJPJ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.19 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|