C14H12N4O2 — CID 17190
1,4,5,8-tetraaminoanthracene-9,10-dione (PubChem CID 17190) has the molecular formula C14H12N4O2 and a molecular weight of 268.28 g/mol. Its IUPAC name is 1,4,5,8-tetraaminoanthracene-9,10-dione.
| Compound Name | 1,4,5,8-tetraaminoanthracene-9,10-dione |
|---|---|
| PubChem CID | 17190 |
| Molecular Formula | C14H12N4O2 |
| Molecular Weight | 268.28 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1,4,5,8-tetraaminoanthracene-9,10-dione |
| SMILES | Nc1ccc(N)c2c1C(=O)c1c(N)ccc(N)c1C2=O |
| InChI | InChI=1S/C14H12N4O2/c15-5-1-2-6(16)10-9(5)13(19)11-7(17)3-4-8(18)12(11)14(10)20/h1-4H,15-18H2 |
| InChIKey | JSFUMBWFPQSADC-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 138.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.28 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|