C22H33N5O5S — CID 171902358
2-[methyl-[(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-7-yl)sulfonyl]amino]-N-(2,2,4-trimethyl-3-oxo-1,4-benzoxazin-7-yl)acetamide (PubChem CID 171902358) has the molecular formula C22H33N5O5S and a molecular weight of 479.60 g/mol. Its IUPAC name is 2-[methyl-[(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-7-yl)sulfonyl]amino]-N-(2,2,4-trimethyl-3-oxo-1,4-benzoxazin-7-yl)acetamide.
| Compound Name | 2-[methyl-[(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-7-yl)sulfonyl]amino]-N-(2,2,4-trimethyl-3-oxo-1,4-benzoxazin-7-yl)acetamide |
|---|---|
| PubChem CID | 171902358 |
| Molecular Formula | C22H33N5O5S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 2-[methyl-[(5-methyl-2,3,3a,4,5,6,7,7a-octahydro-1H-indazol-7-yl)sulfonyl]amino]-N-(2,2,4-trimethyl-3-oxo-1,4-benzoxazin-7-yl)acetamide |
| SMILES | CC1CC2CNNC2C(S(=O)(=O)N(C)CC(=O)Nc2ccc3c(c2)OC(C)(C)C(=O)N3C)C1 |
| InChI | InChI=1S/C22H33N5O5S/c1-13-8-14-11-23-25-20(14)18(9-13)33(30,31)26(4)12-19(28)24-15-6-7-16-17(10-15)32-22(2,3)21(29)27(16)5/h6-7,10,13-14,18,20,23,25H,8-9,11-12H2,1-5H3,(H,24,28) |
| InChIKey | ZNYBJHFBXKLLMB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 120.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |