C25H27F2N5O4S2 — CID 171902440
1-(2-cyclopropyl-1,3-thiazol-5-yl)-3-[5-(difluoromethoxy)-3-pyridinyl]-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-4,5,6,7-tetrahydroindazole-6-carboxamide (PubChem CID 171902440) has the molecular formula C25H27F2N5O4S2 and a molecular weight of 563.65 g/mol. Its IUPAC name is 1-(2-cyclopropyl-1,3-thiazol-5-yl)-3-[5-(difluoromethoxy)-3-pyridinyl]-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-4,5,6,7-tetrahydroindazole-6-carboxamide.
| Compound Name | 1-(2-cyclopropyl-1,3-thiazol-5-yl)-3-[5-(difluoromethoxy)-3-pyridinyl]-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-4,5,6,7-tetrahydroindazole-6-carboxamide |
|---|---|
| PubChem CID | 171902440 |
| Molecular Formula | C25H27F2N5O4S2 |
| Molecular Weight | 563.65 g/mol |
| Exact Mass | 563.15 |
| IUPAC Name | 1-(2-cyclopropyl-1,3-thiazol-5-yl)-3-[5-(difluoromethoxy)-3-pyridinyl]-N-[(3S)-3-methyl-1,1-dioxothiolan-3-yl]-4,5,6,7-tetrahydroindazole-6-carboxamide |
| SMILES | C[C@]1(NC(=O)C2CCc3c(-c4cncc(OC(F)F)c4)nn(-c4cnc(C5CC5)s4)c3C2)CCS(=O)(=O)C1 |
| InChI | InChI=1S/C25H27F2N5O4S2/c1-25(6-7-38(34,35)13-25)30-22(33)15-4-5-18-19(9-15)32(20-12-29-23(37-20)14-2-3-14)31-21(18)16-8-17(11-28-10-16)36-24(26)27/h8,10-12,14-15,24H,2-7,9,13H2,1H3,(H,30,33)/t15?,25-/m0/s1 |
| InChIKey | YBSKWROIOUFUFJ-RZNFBWOTSA-N |
| XLogP | 3.67 |
| TPSA | 116.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.65 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |