C26H24F4N4O4 — CID 171902577
3-[4-[4-[[5-cyclopropyl-3-(2,6-difluorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3-difluoropiperidin-1-yl]phenyl]-1,2,4-oxadiazolidin-5-one (PubChem CID 171902577) has the molecular formula C26H24F4N4O4 and a molecular weight of 532.49 g/mol. Its IUPAC name is 3-[4-[4-[[5-cyclopropyl-3-(2,6-difluorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3-difluoropiperidin-1-yl]phenyl]-1,2,4-oxadiazolidin-5-one.
| Compound Name | 3-[4-[4-[[5-cyclopropyl-3-(2,6-difluorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3-difluoropiperidin-1-yl]phenyl]-1,2,4-oxadiazolidin-5-one |
|---|---|
| PubChem CID | 171902577 |
| Molecular Formula | C26H24F4N4O4 |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 532.17 |
| IUPAC Name | 3-[4-[4-[[5-cyclopropyl-3-(2,6-difluorophenyl)-1,2-oxazol-4-yl]methoxy]-3,3-difluoropiperidin-1-yl]phenyl]-1,2,4-oxadiazolidin-5-one |
| SMILES | O=C1NC(c2ccc(N3CCC(OCc4c(-c5c(F)cccc5F)noc4C4CC4)C(F)(F)C3)cc2)NO1 |
| InChI | InChI=1S/C26H24F4N4O4/c27-18-2-1-3-19(28)21(18)22-17(23(37-32-22)14-4-5-14)12-36-20-10-11-34(13-26(20,29)30)16-8-6-15(7-9-16)24-31-25(35)38-33-24/h1-3,6-9,14,20,24,33H,4-5,10-13H2,(H,31,35) |
| InChIKey | OLSLVMUDZDRVBJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |