C28H28F3N5O5 — CID 171902584
3-[6-[(1R,5S)-3-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-8-azabicyclo[3.2.1]octan-8-yl]-3-pyridinyl]-1,2,4-oxadiazolidin-5-one (PubChem CID 171902584) has the molecular formula C28H28F3N5O5 and a molecular weight of 571.56 g/mol. Its IUPAC name is 3-[6-[(1R,5S)-3-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-8-azabicyclo[3.2.1]octan-8-yl]-3-pyridinyl]-1,2,4-oxadiazolidin-5-one.
| Compound Name | 3-[6-[(1R,5S)-3-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-8-azabicyclo[3.2.1]octan-8-yl]-3-pyridinyl]-1,2,4-oxadiazolidin-5-one |
|---|---|
| PubChem CID | 171902584 |
| Molecular Formula | C28H28F3N5O5 |
| Molecular Weight | 571.56 g/mol |
| Exact Mass | 571.20 |
| IUPAC Name | 3-[6-[(1R,5S)-3-[[5-cyclopropyl-3-[2-(trifluoromethoxy)phenyl]-1,2-oxazol-4-yl]methoxy]-8-azabicyclo[3.2.1]octan-8-yl]-3-pyridinyl]-1,2,4-oxadiazolidin-5-one |
| SMILES | O=C1NC(c2ccc(N3[C@@H]4CC[C@H]3CC(OCc3c(-c5ccccc5OC(F)(F)F)noc3C3CC3)C4)nc2)NO1 |
| InChI | InChI=1S/C28H28F3N5O5/c29-28(30,31)39-22-4-2-1-3-20(22)24-21(25(40-34-24)15-5-6-15)14-38-19-11-17-8-9-18(12-19)36(17)23-10-7-16(13-32-23)26-33-27(37)41-35-26/h1-4,7,10,13,15,17-19,26,35H,5-6,8-9,11-12,14H2,(H,33,37)/t17-,18+,19?,26? |
| InChIKey | SJOWSQKECMNRLN-SJCABOPASA-N |
| XLogP | 5.47 |
| TPSA | 110.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.56 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |