C32H27ClN4O3 — CID 171902782
7-[2-chloro-6-(1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)phenyl]-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione (PubChem CID 171902782) has the molecular formula C32H27ClN4O3 and a molecular weight of 551.05 g/mol. Its IUPAC name is 7-[2-chloro-6-(1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)phenyl]-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione.
| Compound Name | 7-[2-chloro-6-(1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)phenyl]-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 171902782 |
| Molecular Formula | C32H27ClN4O3 |
| Molecular Weight | 551.05 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | 7-[2-chloro-6-(1-oxo-3,4-dihydro-2H-isoquinolin-5-yl)phenyl]-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
| SMILES | O=C1NCCc2c1cccc2-c1cccc(Cl)c1C1CCC2C(=O)N(c3cncc4ccccc34)C(=O)NC2C1 |
| InChI | InChI=1S/C32H27ClN4O3/c33-26-10-4-8-23(21-7-3-9-24-22(21)13-14-35-30(24)38)29(26)18-11-12-25-27(15-18)36-32(40)37(31(25)39)28-17-34-16-19-5-1-2-6-20(19)28/h1-10,16-18,25,27H,11-15H2,(H,35,38)(H,36,40) |
| InChIKey | BHXVTXGIJLOADB-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.05 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |