C25H20F2N4O3 — CID 171902790
5-fluoro-2-(6-fluoro-3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)-4-methoxybenzonitrile (PubChem CID 171902790) has the molecular formula C25H20F2N4O3 and a molecular weight of 462.46 g/mol. Its IUPAC name is 5-fluoro-2-(6-fluoro-3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)-4-methoxybenzonitrile.
| Compound Name | 5-fluoro-2-(6-fluoro-3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)-4-methoxybenzonitrile |
|---|---|
| PubChem CID | 171902790 |
| Molecular Formula | C25H20F2N4O3 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | 5-fluoro-2-(6-fluoro-3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)-4-methoxybenzonitrile |
| SMILES | COc1cc(C2CC3NC(=O)N(c4cncc5ccccc45)C(=O)C3CC2F)c(C#N)cc1F |
| InChI | InChI=1S/C25H20F2N4O3/c1-34-23-9-16(14(10-28)6-20(23)27)17-8-21-18(7-19(17)26)24(32)31(25(33)30-21)22-12-29-11-13-4-2-3-5-15(13)22/h2-6,9,11-12,17-19,21H,7-8H2,1H3,(H,30,33) |
| InChIKey | RGXAGMOGYUOEKN-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |