C29H22ClF3N4O2 — CID 171902794
7-[2-chloro-6-[5-(trifluoromethyl)-3-pyridinyl]phenyl]-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione (PubChem CID 171902794) has the molecular formula C29H22ClF3N4O2 and a molecular weight of 550.97 g/mol. Its IUPAC name is 7-[2-chloro-6-[5-(trifluoromethyl)-3-pyridinyl]phenyl]-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione.
| Compound Name | 7-[2-chloro-6-[5-(trifluoromethyl)-3-pyridinyl]phenyl]-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 171902794 |
| Molecular Formula | C29H22ClF3N4O2 |
| Molecular Weight | 550.97 g/mol |
| Exact Mass | 550.14 |
| IUPAC Name | 7-[2-chloro-6-[5-(trifluoromethyl)-3-pyridinyl]phenyl]-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
| SMILES | O=C1NC2CC(c3c(Cl)cccc3-c3cncc(C(F)(F)F)c3)CCC2C(=O)N1c1cncc2ccccc12 |
| InChI | InChI=1S/C29H22ClF3N4O2/c30-23-7-3-6-21(18-10-19(14-34-13-18)29(31,32)33)26(23)16-8-9-22-24(11-16)36-28(39)37(27(22)38)25-15-35-12-17-4-1-2-5-20(17)25/h1-7,10,12-16,22,24H,8-9,11H2,(H,36,39) |
| InChIKey | PVIGZHWUZANRFE-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.97 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |