C24H21ClFN3O3 — CID 171902800
7-(2-chloro-3-fluoro-5-methoxyphenyl)-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione (PubChem CID 171902800) has the molecular formula C24H21ClFN3O3 and a molecular weight of 453.90 g/mol. Its IUPAC name is 7-(2-chloro-3-fluoro-5-methoxyphenyl)-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione.
| Compound Name | 7-(2-chloro-3-fluoro-5-methoxyphenyl)-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 171902800 |
| Molecular Formula | C24H21ClFN3O3 |
| Molecular Weight | 453.90 g/mol |
| Exact Mass | 453.13 |
| IUPAC Name | 7-(2-chloro-3-fluoro-5-methoxyphenyl)-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
| SMILES | COc1cc(F)c(Cl)c(C2CCC3C(=O)N(c4cncc5ccccc45)C(=O)NC3C2)c1 |
| InChI | InChI=1S/C24H21ClFN3O3/c1-32-15-9-18(22(25)19(26)10-15)13-6-7-17-20(8-13)28-24(31)29(23(17)30)21-12-27-11-14-4-2-3-5-16(14)21/h2-5,9-13,17,20H,6-8H2,1H3,(H,28,31) |
| InChIKey | PEGPWMMQZRRXLO-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.90 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |