C23H19ClFN3O2 — CID 171902810
7-(2-chlorophenyl)-5-fluoro-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione (PubChem CID 171902810) has the molecular formula C23H19ClFN3O2 and a molecular weight of 423.88 g/mol. Its IUPAC name is 7-(2-chlorophenyl)-5-fluoro-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione.
| Compound Name | 7-(2-chlorophenyl)-5-fluoro-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 171902810 |
| Molecular Formula | C23H19ClFN3O2 |
| Molecular Weight | 423.88 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | 7-(2-chlorophenyl)-5-fluoro-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
| SMILES | O=C1NC2CC(c3ccccc3Cl)CC(F)C2C(=O)N1c1cncc2ccccc12 |
| InChI | InChI=1S/C23H19ClFN3O2/c24-17-8-4-3-6-15(17)14-9-18(25)21-19(10-14)27-23(30)28(22(21)29)20-12-26-11-13-5-1-2-7-16(13)20/h1-8,11-12,14,18-19,21H,9-10H2,(H,27,30) |
| InChIKey | JZGRFRACPVFXGQ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.88 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |