C30H24ClFN4O3 — CID 171902848
5-[3-chloro-2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)phenyl]-2-fluorobenzamide (PubChem CID 171902848) has the molecular formula C30H24ClFN4O3 and a molecular weight of 543.00 g/mol. Its IUPAC name is 5-[3-chloro-2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)phenyl]-2-fluorobenzamide.
| Compound Name | 5-[3-chloro-2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)phenyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 171902848 |
| Molecular Formula | C30H24ClFN4O3 |
| Molecular Weight | 543.00 g/mol |
| Exact Mass | 542.15 |
| IUPAC Name | 5-[3-chloro-2-(3-isoquinolin-4-yl-2,4-dioxo-4a,5,6,7,8,8a-hexahydro-1H-quinazolin-7-yl)phenyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cccc(Cl)c2C2CCC3C(=O)N(c4cncc5ccccc45)C(=O)NC3C2)ccc1F |
| InChI | InChI=1S/C30H24ClFN4O3/c31-23-7-3-6-20(16-9-11-24(32)22(12-16)28(33)37)27(23)17-8-10-21-25(13-17)35-30(39)36(29(21)38)26-15-34-14-18-4-1-2-5-19(18)26/h1-7,9,11-12,14-15,17,21,25H,8,10,13H2,(H2,33,37)(H,35,39) |
| InChIKey | VDFGVQIUPYNMNK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 105.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.00 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |