C21H12ClF2N3O2S — CID 171902874
6-(2-chloro-4,5-difluorophenyl)-3-isoquinolin-4-yl-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 171902874) has the molecular formula C21H12ClF2N3O2S and a molecular weight of 443.86 g/mol. Its IUPAC name is 6-(2-chloro-4,5-difluorophenyl)-3-isoquinolin-4-yl-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 6-(2-chloro-4,5-difluorophenyl)-3-isoquinolin-4-yl-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171902874 |
| Molecular Formula | C21H12ClF2N3O2S |
| Molecular Weight | 443.86 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | 6-(2-chloro-4,5-difluorophenyl)-3-isoquinolin-4-yl-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=C1NC2C=C(c3cc(F)c(F)cc3Cl)SC2C(=O)N1c1cncc2ccccc12 |
| InChI | InChI=1S/C21H12ClF2N3O2S/c22-13-6-15(24)14(23)5-12(13)18-7-16-19(30-18)20(28)27(21(29)26-16)17-9-25-8-10-3-1-2-4-11(10)17/h1-9,16,19H,(H,26,29) |
| InChIKey | IMUZWUFXTMIFCD-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.86 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|