C21H15ClN4O2S — CID 171902878
6-(2-chloro-4-methyl-3-pyridinyl)-3-isoquinolin-4-yl-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 171902878) has the molecular formula C21H15ClN4O2S and a molecular weight of 422.90 g/mol. Its IUPAC name is 6-(2-chloro-4-methyl-3-pyridinyl)-3-isoquinolin-4-yl-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 6-(2-chloro-4-methyl-3-pyridinyl)-3-isoquinolin-4-yl-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171902878 |
| Molecular Formula | C21H15ClN4O2S |
| Molecular Weight | 422.90 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | 6-(2-chloro-4-methyl-3-pyridinyl)-3-isoquinolin-4-yl-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | Cc1ccnc(Cl)c1C1=CC2NC(=O)N(c3cncc4ccccc34)C(=O)C2S1 |
| InChI | InChI=1S/C21H15ClN4O2S/c1-11-6-7-24-19(22)17(11)16-8-14-18(29-16)20(27)26(21(28)25-14)15-10-23-9-12-4-2-3-5-13(12)15/h2-10,14,18H,1H3,(H,25,28) |
| InChIKey | JYSVHWSZWRCKPB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.90 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|