C24H20ClF2N3O3 — CID 171902918
7-[2-chloro-5-(difluoromethoxy)phenyl]-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione (PubChem CID 171902918) has the molecular formula C24H20ClF2N3O3 and a molecular weight of 471.89 g/mol. Its IUPAC name is 7-[2-chloro-5-(difluoromethoxy)phenyl]-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione.
| Compound Name | 7-[2-chloro-5-(difluoromethoxy)phenyl]-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 171902918 |
| Molecular Formula | C24H20ClF2N3O3 |
| Molecular Weight | 471.89 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | 7-[2-chloro-5-(difluoromethoxy)phenyl]-3-isoquinolin-4-yl-4a,5,6,7,8,8a-hexahydro-1H-quinazoline-2,4-dione |
| SMILES | O=C1NC2CC(c3cc(OC(F)F)ccc3Cl)CCC2C(=O)N1c1cncc2ccccc12 |
| InChI | InChI=1S/C24H20ClF2N3O3/c25-19-8-6-15(33-23(26)27)10-18(19)13-5-7-17-20(9-13)29-24(32)30(22(17)31)21-12-28-11-14-3-1-2-4-16(14)21/h1-4,6,8,10-13,17,20,23H,5,7,9H2,(H,29,32) |
| InChIKey | ICXGMSQWZLADJD-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.89 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |