C21H17ClF3N3O4S — CID 171902961
6-(2-chloro-5-methoxyphenyl)-3-[5-methyl-4-(2,2,2-trifluoroethoxy)-3-pyridinyl]-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 171902961) has the molecular formula C21H17ClF3N3O4S and a molecular weight of 499.90 g/mol. Its IUPAC name is 6-(2-chloro-5-methoxyphenyl)-3-[5-methyl-4-(2,2,2-trifluoroethoxy)-3-pyridinyl]-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 6-(2-chloro-5-methoxyphenyl)-3-[5-methyl-4-(2,2,2-trifluoroethoxy)-3-pyridinyl]-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171902961 |
| Molecular Formula | C21H17ClF3N3O4S |
| Molecular Weight | 499.90 g/mol |
| Exact Mass | 499.06 |
| IUPAC Name | 6-(2-chloro-5-methoxyphenyl)-3-[5-methyl-4-(2,2,2-trifluoroethoxy)-3-pyridinyl]-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(Cl)c(C2=CC3NC(=O)N(c4cncc(C)c4OCC(F)(F)F)C(=O)C3S2)c1 |
| InChI | InChI=1S/C21H17ClF3N3O4S/c1-10-7-26-8-15(17(10)32-9-21(23,24)25)28-19(29)18-14(27-20(28)30)6-16(33-18)12-5-11(31-2)3-4-13(12)22/h3-8,14,18H,9H2,1-2H3,(H,27,30) |
| InChIKey | IROCXMPYHWMHDB-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.90 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |