C20H12ClF3N4O3S2 — CID 171903056
6-(2-chloro-5-methoxyphenyl)-3-[2-(trifluoromethyl)-[1,3]thiazolo[4,5-c]pyridin-7-yl]-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 171903056) has the molecular formula C20H12ClF3N4O3S2 and a molecular weight of 512.92 g/mol. Its IUPAC name is 6-(2-chloro-5-methoxyphenyl)-3-[2-(trifluoromethyl)-[1,3]thiazolo[4,5-c]pyridin-7-yl]-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 6-(2-chloro-5-methoxyphenyl)-3-[2-(trifluoromethyl)-[1,3]thiazolo[4,5-c]pyridin-7-yl]-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171903056 |
| Molecular Formula | C20H12ClF3N4O3S2 |
| Molecular Weight | 512.92 g/mol |
| Exact Mass | 512.00 |
| IUPAC Name | 6-(2-chloro-5-methoxyphenyl)-3-[2-(trifluoromethyl)-[1,3]thiazolo[4,5-c]pyridin-7-yl]-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | COc1ccc(Cl)c(C2=CC3NC(=O)N(c4cncc5nc(C(F)(F)F)sc45)C(=O)C3S2)c1 |
| InChI | InChI=1S/C20H12ClF3N4O3S2/c1-31-8-2-3-10(21)9(4-8)14-5-11-16(32-14)17(29)28(19(30)27-11)13-7-25-6-12-15(13)33-18(26-12)20(22,23)24/h2-7,11,16H,1H3,(H,27,30) |
| InChIKey | HOUJRKHFVSLCKQ-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.92 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |