C20H13ClF3N5O2S — CID 171903063
6-(2-chlorophenyl)-3-[2-(2,2,2-trifluoroethyl)pyrazolo[4,3-c]pyridin-7-yl]-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 171903063) has the molecular formula C20H13ClF3N5O2S and a molecular weight of 479.87 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-3-[2-(2,2,2-trifluoroethyl)pyrazolo[4,3-c]pyridin-7-yl]-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 6-(2-chlorophenyl)-3-[2-(2,2,2-trifluoroethyl)pyrazolo[4,3-c]pyridin-7-yl]-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171903063 |
| Molecular Formula | C20H13ClF3N5O2S |
| Molecular Weight | 479.87 g/mol |
| Exact Mass | 479.04 |
| IUPAC Name | 6-(2-chlorophenyl)-3-[2-(2,2,2-trifluoroethyl)pyrazolo[4,3-c]pyridin-7-yl]-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=C1NC2C=C(c3ccccc3Cl)SC2C(=O)N1c1cncc2cn(CC(F)(F)F)nc12 |
| InChI | InChI=1S/C20H13ClF3N5O2S/c21-12-4-2-1-3-11(12)15-5-13-17(32-15)18(30)29(19(31)26-13)14-7-25-6-10-8-28(27-16(10)14)9-20(22,23)24/h1-8,13,17H,9H2,(H,26,31) |
| InChIKey | FNUHEQRYPNKRLO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 80.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.87 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |