C20H16ClN3O3S — CID 171903155
6-(2-chlorophenyl)-3-(3,4-dihydro-2H-pyrano[2,3-c]pyridin-5-yl)-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 171903155) has the molecular formula C20H16ClN3O3S and a molecular weight of 413.89 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-3-(3,4-dihydro-2H-pyrano[2,3-c]pyridin-5-yl)-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 6-(2-chlorophenyl)-3-(3,4-dihydro-2H-pyrano[2,3-c]pyridin-5-yl)-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171903155 |
| Molecular Formula | C20H16ClN3O3S |
| Molecular Weight | 413.89 g/mol |
| Exact Mass | 413.06 |
| IUPAC Name | 6-(2-chlorophenyl)-3-(3,4-dihydro-2H-pyrano[2,3-c]pyridin-5-yl)-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | O=C1NC2C=C(c3ccccc3Cl)SC2C(=O)N1c1cncc2c1CCCO2 |
| InChI | InChI=1S/C20H16ClN3O3S/c21-13-6-2-1-4-11(13)17-8-14-18(28-17)19(25)24(20(26)23-14)15-9-22-10-16-12(15)5-3-7-27-16/h1-2,4,6,8-10,14,18H,3,5,7H2,(H,23,26) |
| InChIKey | NAJLOUYUMBMPIE-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.89 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |