C24H21ClN6O2S — CID 171903180
6-(2-chlorophenyl)-3-(5-cyclopropyl-3-pyridinyl)-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]-4a,7a-dihydrothieno[3,2-d]pyrimidine-2,4-dione (PubChem CID 171903180) has the molecular formula C24H21ClN6O2S and a molecular weight of 492.99 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-3-(5-cyclopropyl-3-pyridinyl)-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]-4a,7a-dihydrothieno[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 6-(2-chlorophenyl)-3-(5-cyclopropyl-3-pyridinyl)-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]-4a,7a-dihydrothieno[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171903180 |
| Molecular Formula | C24H21ClN6O2S |
| Molecular Weight | 492.99 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 6-(2-chlorophenyl)-3-(5-cyclopropyl-3-pyridinyl)-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]-4a,7a-dihydrothieno[3,2-d]pyrimidine-2,4-dione |
| SMILES | Cn1cnc(CN2C(=O)N(c3cncc(C4CC4)c3)C(=O)C3SC(c4ccccc4Cl)=CC32)n1 |
| InChI | InChI=1S/C24H21ClN6O2S/c1-29-13-27-21(28-29)12-30-19-9-20(17-4-2-3-5-18(17)25)34-22(19)23(32)31(24(30)33)16-8-15(10-26-11-16)14-6-7-14/h2-5,8-11,13-14,19,22H,6-7,12H2,1H3 |
| InChIKey | BOZWOBKBYWEEGO-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.99 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |