C23H18ClFN4O4S2 — CID 171903526
7-[6-(2-chloro-4-fluoro-5-methoxyphenyl)-2,4-dioxo-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidin-3-yl]-N,N-dimethylthieno[3,2-c]pyridine-2-carboxamide (PubChem CID 171903526) has the molecular formula C23H18ClFN4O4S2 and a molecular weight of 533.01 g/mol. Its IUPAC name is 7-[6-(2-chloro-4-fluoro-5-methoxyphenyl)-2,4-dioxo-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidin-3-yl]-N,N-dimethylthieno[3,2-c]pyridine-2-carboxamide.
| Compound Name | 7-[6-(2-chloro-4-fluoro-5-methoxyphenyl)-2,4-dioxo-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidin-3-yl]-N,N-dimethylthieno[3,2-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 171903526 |
| Molecular Formula | C23H18ClFN4O4S2 |
| Molecular Weight | 533.01 g/mol |
| Exact Mass | 532.04 |
| IUPAC Name | 7-[6-(2-chloro-4-fluoro-5-methoxyphenyl)-2,4-dioxo-4a,7a-dihydro-1H-thieno[3,2-d]pyrimidin-3-yl]-N,N-dimethylthieno[3,2-c]pyridine-2-carboxamide |
| SMILES | COc1cc(C2=CC3NC(=O)N(c4cncc5cc(C(=O)N(C)C)sc45)C(=O)C3S2)c(Cl)cc1F |
| InChI | InChI=1S/C23H18ClFN4O4S2/c1-28(2)21(30)18-4-10-8-26-9-15(19(10)35-18)29-22(31)20-14(27-23(29)32)7-17(34-20)11-5-16(33-3)13(25)6-12(11)24/h4-9,14,20H,1-3H3,(H,27,32) |
| InChIKey | OQCNLHCQPKVURW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 91.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.01 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |