C26H28F3N3O4 — CID 171903827
N-(1,6-dimethyl-9H-xanthen-9-yl)-5-morpholin-4-yl-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171903827) has the molecular formula C26H28F3N3O4 and a molecular weight of 503.52 g/mol. Its IUPAC name is N-(1,6-dimethyl-9H-xanthen-9-yl)-5-morpholin-4-yl-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-(1,6-dimethyl-9H-xanthen-9-yl)-5-morpholin-4-yl-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171903827 |
| Molecular Formula | C26H28F3N3O4 |
| Molecular Weight | 503.52 g/mol |
| Exact Mass | 503.20 |
| IUPAC Name | N-(1,6-dimethyl-9H-xanthen-9-yl)-5-morpholin-4-yl-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc2c(c1)Oc1cccc(C)c1C2NC(=O)C1CC(N2CCOCC2)C(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C26H28F3N3O4/c1-14-6-7-16-20(12-14)36-19-5-3-4-15(2)21(19)22(16)30-24(33)17-13-18(32-8-10-35-11-9-32)23(26(27,28)29)31-25(17)34/h3-7,12,17-18,22-23H,8-11,13H2,1-2H3,(H,30,33)(H,31,34) |
| InChIKey | JLBUDGZTBWVIKJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|