C27H30F3N3O3 — CID 171903829
N-(1,6-dimethyl-9H-xanthen-9-yl)-2-oxo-5-piperidin-1-yl-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171903829) has the molecular formula C27H30F3N3O3 and a molecular weight of 501.55 g/mol. Its IUPAC name is N-(1,6-dimethyl-9H-xanthen-9-yl)-2-oxo-5-piperidin-1-yl-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-(1,6-dimethyl-9H-xanthen-9-yl)-2-oxo-5-piperidin-1-yl-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171903829 |
| Molecular Formula | C27H30F3N3O3 |
| Molecular Weight | 501.55 g/mol |
| Exact Mass | 501.22 |
| IUPAC Name | N-(1,6-dimethyl-9H-xanthen-9-yl)-2-oxo-5-piperidin-1-yl-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | Cc1ccc2c(c1)Oc1cccc(C)c1C2NC(=O)C1CC(N2CCCCC2)C(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C27H30F3N3O3/c1-15-9-10-17-21(13-15)36-20-8-6-7-16(2)22(20)23(17)31-25(34)18-14-19(33-11-4-3-5-12-33)24(27(28,29)30)32-26(18)35/h6-10,13,18-19,23-24H,3-5,11-12,14H2,1-2H3,(H,31,34)(H,32,35) |
| InChIKey | LHFCSPAQSIMXOD-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|