C28H33F3N4O3 — CID 171903867
N-(3,6-dimethyl-9H-xanthen-9-yl)-5-(4-ethylpiperazin-1-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171903867) has the molecular formula C28H33F3N4O3 and a molecular weight of 530.59 g/mol. Its IUPAC name is N-(3,6-dimethyl-9H-xanthen-9-yl)-5-(4-ethylpiperazin-1-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-(3,6-dimethyl-9H-xanthen-9-yl)-5-(4-ethylpiperazin-1-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171903867 |
| Molecular Formula | C28H33F3N4O3 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.25 |
| IUPAC Name | N-(3,6-dimethyl-9H-xanthen-9-yl)-5-(4-ethylpiperazin-1-yl)-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | CCN1CCN(C2CC(C(=O)NC3c4ccc(C)cc4Oc4cc(C)ccc43)C(=O)NC2C(F)(F)F)CC1 |
| InChI | InChI=1S/C28H33F3N4O3/c1-4-34-9-11-35(12-10-34)21-15-20(27(37)33-25(21)28(29,30)31)26(36)32-24-18-7-5-16(2)13-22(18)38-23-14-17(3)6-8-19(23)24/h5-8,13-14,20-21,24-25H,4,9-12,15H2,1-3H3,(H,32,36)(H,33,37) |
| InChIKey | VKDMJHSKPYEMIQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|