C19H23F3N2O3 — CID 171904041
N-[(2S)-5-methyl-2-propyl-2,3-dihydro-1-benzofuran-3-yl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide (PubChem CID 171904041) has the molecular formula C19H23F3N2O3 and a molecular weight of 384.40 g/mol. Its IUPAC name is N-[(2S)-5-methyl-2-propyl-2,3-dihydro-1-benzofuran-3-yl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide.
| Compound Name | N-[(2S)-5-methyl-2-propyl-2,3-dihydro-1-benzofuran-3-yl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 171904041 |
| Molecular Formula | C19H23F3N2O3 |
| Molecular Weight | 384.40 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | N-[(2S)-5-methyl-2-propyl-2,3-dihydro-1-benzofuran-3-yl]-2-oxo-6-(trifluoromethyl)piperidine-3-carboxamide |
| SMILES | CCC[C@@H]1Oc2ccc(C)cc2C1NC(=O)C1CCC(C(F)(F)F)NC1=O |
| InChI | InChI=1S/C19H23F3N2O3/c1-3-4-14-16(12-9-10(2)5-7-13(12)27-14)24-18(26)11-6-8-15(19(20,21)22)23-17(11)25/h5,7,9,11,14-16H,3-4,6,8H2,1-2H3,(H,23,25)(H,24,26)/t11?,14-,15?,16?/m0/s1 |
| InChIKey | MBDSTGNJZNSQNY-YIVNGKDISA-N |
| XLogP | 3.17 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.40 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|