C24H28FN3O — CID 171904172
1-(4-fluorophenyl)-4-(11-methyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraen-5-yl)butan-1-ol (PubChem CID 171904172) has the molecular formula C24H28FN3O and a molecular weight of 393.51 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(11-methyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraen-5-yl)butan-1-ol.
| Compound Name | 1-(4-fluorophenyl)-4-(11-methyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraen-5-yl)butan-1-ol |
|---|---|
| PubChem CID | 171904172 |
| Molecular Formula | C24H28FN3O |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.22 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(11-methyl-2,5,11-triazatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),9,12(16),13-tetraen-5-yl)butan-1-ol |
| SMILES | Cn1cc2c3c(cccc31)N1CCN(CCCC(O)c3ccc(F)cc3)CC1C2 |
| InChI | InChI=1S/C24H28FN3O/c1-26-15-18-14-20-16-27(11-3-6-23(29)17-7-9-19(25)10-8-17)12-13-28(20)22-5-2-4-21(26)24(18)22/h2,4-5,7-10,15,20,23,29H,3,6,11-14,16H2,1H3 |
| InChIKey | UWGYDHMOJGSZMF-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 31.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |